1214319-92-2
1214319-92-2
Chemical Structure
Azido-PEG8-acid
- CAS No.: 1214319-92-2
- Formula:C19H37N3O10
- Molecular Weight:467.51
IUPAC Name: 1-azido-3,6,9,12,15,18,21,24-octaoxaheptacosan-27-oic acid
InChIKey: URUGOEBULOZLBF-UHFFFAOYSA-N
SMILES: O=C(O)CCOCCOCCOCCOCCOCCOCCOCCOCCN=[N+]=[N-]
Biological Activity: Azido-PEG8-acid is a non-cleavable 8 unit PEG ADC linker used in the synthesis of antibody-drug conjugates (ADCs). Azido-PEG8-acid is also a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. Azido-PEG8-acid is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups.
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Azido-PEG8-acid | 98.0% | Azido-PEG8-acid is a non-cleavable 8 unit PEG ADC linker used in the synthesis of antibody-drug conjugates (ADCs). Azido-PEG8-acid is also a PEG-based PROTAC linker that can be used in the synthesis of PROTACs. Azido-PEG8-acid is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
N3-PEG8-CH2COOH | N3-PEG8-CH2COOH is a PEG-based PROTAC linker can be used in the synthesis of PROTACs. N3-PEG8-CH2COOH is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Azido-PEG9-acid | 97.74% | Azido-PEG9-acid is a non-cleavable 9 unit PEG ADC linker used in the synthesis of antibody-drug conjugates (ADCs). Azido-PEG9-acid is a PEG-based PROTAC linker can be used in the synthesis of PROTACs. Azido-PEG9-acid is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Thiol-PEG8-acid | 97.0% | Thiol-PEG8-acid is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
HO-PEG8-CH2CH2COOH | 99.94% | HO-PEG8-CH2CH2COOH (Hydroxy-PEG8-acid) is a PEG derivative containing a hydroxyl group with a terminal carboxylic acid. The terminal carboxylic acid can be reacted with primary amine groups in the presence of activators to form a stable amide bond. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
m-PEG9-azide | m-PEG9-azide is a PEG-based PROTAC linker can be used in the synthesis of PROTACs. m-PEG9-azide is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Azido-PEG8-amine | 99.87% | Azido-PEG8-amine is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs. Azido-PEG8-amine is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Azido-PEG10-acid | 99.88% | Azido-PEG10-acid is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs. Azido-PEG10-acid is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Azido-PEG9-alcohol | 95.0% | Azido-PEG9-alcohol is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs. Azido-PEG9-alcohol is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Azido-PEG8-hydrazide | 96.11% | Azido-PEG8-hydrazide is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs. Azido-PEG8-hydrazide is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
NH2-PEG8-acid | 98.0% | NH2-PEG8-acid is a non-cleavable 8 unit PEG ADC linker used in the synthesis of antibody-drug conjugates (ADCs). NH2-PEG8-acid also is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
