129280-33-7
129280-33-7
Chemical Structure
Semilicoisoflavone B
- CAS No.: 129280-33-7
- Formula:C20H16O6
- Molecular Weight:352.34
IUPAC Name: 5,7,8'-trihydroxy-2',2'-dimethyl-2'H,4H-[3,6'-bichromen]-4-one
InChIKey: LWZACZCRAUQSLH-UHFFFAOYSA-N
SMILES: O=C1C(C2=CC(O)=C3C(C=CC(C)(C)O3)=C2)=COC4=CC(O)=CC(O)=C14
Biological Activity: Semilicoisoflavone B, an isoflavone, mainly derived from Glycyrrhiza uralensis Fisch.. Semilicoisoflavone B reduces amyloid β (Aβ) secretion by inhibiting β-secretase-1 (BACE1) expression and activity. Semilicoisoflavone B decreases BACE1 expression mainly through increasing PPARγ expression and inhibiting STAT3 phosphorylation[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Semilicoisoflavone B | 99.90% | Semilicoisoflavone B, an isoflavone, mainly derived from Glycyrrhiza uralensis Fisch.. Semilicoisoflavone B reduces amyloid β (Aβ) secretion by inhibiting β-secretase-1 (BACE1) expression and activity. Semilicoisoflavone B decreases BACE1 expression mainly through increasing PPARγ expression and inhibiting STAT3 phosphorylation. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Corylin (Standard) | ≥98% | Corylin (Standard) is the analytical standard of Corylin. This product is intended for research and analytical applications. Corylin is an orally active flavonoid anti-inflammatory and osteogenic agent that inhibits IL-6-induced STAT3 promoter activity and STAT3 phosphorylation. Corylin also has anticancer, antiatherosclerotic, and ameliorating activity in hyperlipidemia and insulin resistance, inducing adipocyte browning and lipolysis through SIRT1 or β3-AR-dependent pathways. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Sophoraisoflavone A | 99.33% | Sophoraisoflavone A (Allolicoisoflavone B) is a nature product that could be isolated from Glycyrrhiza inflate. Sophoraisoflavone A is a potent protein tyrosine phosphatase 1B (PTP1B) inhibitor with an IC50 value of 0.80 μM. Sophoraisoflavone A can be used in research of inflammation. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
2'-Prenylsemilicoisoflavone B | 2'-Prenylsemilicoisoflavone B is a natural flavonoid. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
6-Demethoxyirigenin | 6-Demethoxyirigenin is a natural flavonoid. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Parvisoflavone B | Parvisoflavone B is a prenylated flavonoid. Parvisoflavone B can be isolated from root bark of Erythrina mildbraedii. Parvisoflavone B inhibits PTP1B activity with an IC50 of 42.6 μM. Parvisoflavone B inhibits α-glucosidase with an IC50 of 12.19 μM. Parvisoflavone B can be used in the research of type 2 diabetes and obesity. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
O-Demethylforbexanthone | O-Demethylforbexanthone (7,9,12-Trihydroxy-2,2-dimethyl-2H,6H-pyrano[3,2-b]xanthen-6-one) is a Triterpenoids product that can be isolated from the herbs of Jatropha curcas.. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Licoisoflavone B | 99.46% | Licoisoflavone B is an orally active flavonoid found in licorice. Licoisoflavone B alleviates psoriasis via SCD1-targeted lipid metabolism reprogramming and suppression of Th17/IL-17-mediated inflammation. Licoisoflavone B inhiibits superoxide anion generation and superoxide anion-induced lipid peroxidation. Licoisoflavone B binds tightly to Lassa virus nucleoprotein and can be used as a nucleoprotein antagonist of Lassa virus. Licoisoflavone B exhibits anti-mutagenic activity against carcinogenic mutagen, by preventing DNA damage. Licoisoflavone B can be used for the research of psoriasis, Lassa fever, inflammation and cancer. |
||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Isoderrone | 98.12% | Isoderrone is a new isoflavone isolated from the methanol extractives from white lupin (cv. Kievskij Mutant) roots. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Glycyrrhisoflavone | 99.43% | Glycyrrhisoflavone, an active prenylflavonoid, inhibits α-glucosidase. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Pratensein | 99.92% | Pratensein, a flavonoid, ameliorates β-amyloid-induced cognitive impairment in rats via reducing oxidative damage and restoring synapse and BDNF levels. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
