1411977-95-1
Chemical Structure
Acetylene-linker-Val-Cit-PABC-MMAE
Synonym(s): LCB14-0602
- CAS No.: 1411977-95-1
- Formula:C67H106N10O16
- Molecular Weight:1307.62
IUPAC Name: 4-((2S,5S)-5-isopropyl-4,7-dioxo-2-(3-ureidopropyl)-9,12,15-trioxa-3,6-diazaoctadec-17-ynamido)benzyl ((S)-1-(((S)-1-(((3R,4S,5S)-1-((S)-2-((1R,2R)-3-(((1S,2R)-1-hydroxy-1-phenylpropan-2-yl)amino)-1-methoxy-2-methyl-3-oxopropyl)pyrrolidin-1-yl)-3-methoxy-5-methyl-1-oxoheptan-4-yl)(methyl)amino)-3-methyl-1-oxobutan-2-yl)amino)-3-methyl-1-oxobutan-2-yl)(methyl)carbamate
InChIKey: HJNJEHBZUVWTEJ-MKXMLHHLSA-N
SMILES: O=C([C@H](CCCNC(N)=O)NC([C@H](C(C)C)NC(COCCOCCOCC#C)=O)=O)NC1=CC=C(COC(N(C)[C@@H](C(C)C)C(N[C@@H](C(C)C)C(N([C@H]([C@@H](CC(N2[C@H]([C@H](OC)[C@H](C(N[C@@H]([C@@H](O)C3=CC=CC=C3)C)=O)C)CCC2)=O)OC)[C@@H](C)CC)C)=O)=O)=O)C=C1
Biological Activity: Acetylene-linker-Val-Cit-PABC-MMAE (LCB14-0602) consists the ADCs linker (Acetylene-linker-Val-Cit-PABC) and potent tubulin inhibitor (MMAE). Acetylene-linker-Val-Cit-PABC-MMAE (LCB14-0602) is a agent-linker conjugate for ADC. Acetylene-linker-Val-Cit-PABC-MMAE is a click chemistry reagent, it contains an Alkyne group and can undergo copper-catalyzed azide-alkyne cycloaddition (CuAAc) with molecules containing Azide groups.
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Acetylene-linker-Val-Cit-PABC-MMAE | 99.21% | Acetylene-linker-Val-Cit-PABC-MMAE (LCB14-0602) consists the ADCs linker (Acetylene-linker-Val-Cit-PABC) and potent tubulin inhibitor (MMAE). Acetylene-linker-Val-Cit-PABC-MMAE (LCB14-0602) is a agent-linker conjugate for ADC. Acetylene-linker-Val-Cit-PABC-MMAE is a click chemistry reagent, it contains an Alkyne group and can undergo copper-catalyzed azide-alkyne cycloaddition (CuAAc) with molecules containing Azide groups. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
N3-PEG3-vc-PAB-MMAE | 99.07% | N3-PEG3-vc-PAB-MMAE is a synthesized agent-linker conjugate for ADC that incorporates the MMAE (a tubulin inhibitor ) and 3-unit PEG linker. N3-PEG3-vc-PAB-MMAE shows potent antitumor activity. N3-PEG3-vc-PAB-MMAE is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Gly3-VC-PAB-MMAE | 98.83% | Gly3-VC-PAB-MMAE consists a cleavable ADC linker (Gly3-VC-PAB) and a potent tubulin inhibitor (MMAE). Gly3-VC-PAB-MMAE can be used in the synthesis of antibody-drug conjugates (ADCs). | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Amino-PEG4-Val-Cit-PAB-MMAE | 99.18% | Amino-PEG4-Val-Cit-PAB-MMAE is a cleavable 4 unit PEG ADC linker used in the synthesis of antibody-drug conjugates (ADCs). | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Br-C1-CONH-C5-CO-Val-Cit-PAB-MMAE | 99.23% | Br-C1-CONH-C5-CO-Val-Cit-PAB-MMAE (compound 62) is a drug-linker complex that can be used to synthesize ADCs. Br-C1-CONH-C5-CO-Val-Cit-PAB-MMAE applies to research on breast cancer, anaplastic large cell lymphoma, and lung adenocarcinoma. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
OH-Glu-Val-Cit-PAB-MMAE | 99.03% | OH-Glu-Val-Cit-PAB-MMAE consists a cleavable ADC linker (OH-Glu-Val-Cit-PAB) and a potent tubulin inhibitor (MMAE). SuO-Glu-Val-Cit-PAB-MMAE can be used in the synthesis of antibody-drug conjugates (ADCs). | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
(Aminooxy)acetamide-Val-Cit-PAB-MMAE | 96.87% | (Aminooxy)acetamide-Val-Cit-PAB-MMAE (MMAE 5) is an intermediate used in the synthetic preparation of drug-linker conjugates for ADC. (Aminooxy)acetamide-Val-Cit-PAB-MMAE is conjugated to polyamide via oxime bond formation to form MMAE polyamide conjugate. Then MMAE polyamide conjugate can be conjugated to Trastuzumab, to make ADC. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
LND1002 | 99.20% | NH2-PEG3-VC-PAB-MMAE is a drug-linker conjugate for ADC, consisting of a cleavable ADC linker (NH2-PEG3-VC-PAB) and a potent tubulin inhibitor Monomethyl auristatin E (MMAE) (HY-15162). NH2-PEG3-VC-PAB-MMAE can be used in the synthesis of antibody-drug conjugates (ADCs). | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Boc-Val-Cit-PAB-MMAE | 99.72% | Boc-Val-Cit-PAB-MMAE is a drug-linker conjugate for ADC, which is composed of a linker Boc-Val-Cit-PAB (HY141141) and a Microtubule inhibitor MMAE (HY-15162). Boc-Val-Cit-PAB-MMAE can be used for ADC synthesis. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Aminocaproyl-Val-Cit-PABC-MMAE | 99.89% | Aminocaproyl-Val-Cit-PABC-MMAE is an Drug-linker conjugate for ADC. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Azido-PEG4-Val-Cit-PAB-MMAE | 99.43% | Azido-PEG4-Val-Cit-PAB-MMAE is a agent-linker conjugate for ADC by using the anti-mitotic agent, monomethyl auristatin E (MMAE, a tubulin inhibitor), linked via the cleavable linker Azido-PEG4-Val-Cit-PAB-OH. Azido-PEG4-Val-Cit-PAB-MMAE is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
