143673-61-4
143673-61-4
Chemical Structure
Potassium thiocyanate-13C,15N
Synonym(s): Potassium rhodanide-13C,15N
- CAS No.: 143673-61-4
- Formula:KS13C15N
- Molecular Weight:99.17
InChIKey: ZNNZYHKDIALBAK-AWQJXPNKSA-M
SMILES: [K]S(=S)(S(=S)(S(=S)(S(=S)(SC#CC#CC#CC#CC#CC#CC#CC#N)=S)=S)=S)=S
Biological Activity: Potassium thiocyanate-13C,15N (Potassium rhodanide-13C,15N) is 13C and 15N labeled Potassium thiocyanate[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Potassium thiocyanate-13C,15N | 98.10% | Potassium thiocyanate-13C,15N (Potassium rhodanide-13C,15N) is 13C and 15N labeled Potassium thiocyanate. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Bis-propargyl-PEG8 | Bis-propargyl-PEG8 (compound 16e) is a PEG-based PROTAC linker can be used in the synthesis of PROTACs. Bis-propargyl-PEG8 is a click chemistry reagent, it contains an Alkyne group and can undergo copper-catalyzed azide-alkyne cycloaddition (CuAAc) with molecules containing Azide groups. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Nonaethylene glycol monomethyl ether | 99.89% | Nonaethylene glycol monomethyl ether is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Propargyl-PEG9-OH | Propargyl-PEG9-OH is a PEG-based PROTAC linker can be used in the synthesis of PROTACs. Propargyl-PEG9-OH is a click chemistry reagent, it contains an Alkyne group and can undergo copper-catalyzed azide-alkyne cycloaddition (CuAAc) with molecules containing Azide groups. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Propargyl-PEG8-OH | 98.0% | Propargyl-PEG8-OH is a PEG-based PROTAC linker can be used in the synthesis of PROTACs. Propargyl-PEG8-OH is a click chemistry reagent, it contains an Alkyne group and can undergo copper-catalyzed azide-alkyne cycloaddition (CuAAc) with molecules containing Azide groups. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Bis-propargyl-PEG9 | Bis-propargyl-PEG9 is a PEG-based PROTAC linker used in the synthesis of PROTACs. Bis-propargyl-PEG9 can be used to synthesize the bivalent estrogen receptor ligands. Bis-propargyl-PEG9 is a click chemistry reagent, it contains an Alkyne group and can undergo copper-catalyzed azide-alkyne cycloaddition (CuAAc) with molecules containing Azide groups. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Bis-propargyl-PEG7 | 98.0% | Bis-propargyl-PEG7 is a PEG-based PROTAC linker used in the synthesis of PROTACs. Bis-propargyl-PEG7 can be used to synthesize the polymer linked multimers of guanosine-3', 5'-cyclic monophosphates. Bis-propargyl-PEG7 is a click chemistry reagent, it contains an Alkyne group and can undergo copper-catalyzed azide-alkyne cycloaddition (CuAAc) with molecules containing Azide groups. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
m-PEG8-O-alkyne | 98.0% | m-PEG8-O-alkyne is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs. m-PEG8-O-alkyne is a click chemistry reagent, it contains an Alkyne group and can undergo copper-catalyzed azide-alkyne cycloaddition (CuAAc) with molecules containing Azide groups. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
m-PEG10-alcohol | m-PEG10-alcohol (Decaethylene glycol monomethyl ether) is a non-cleavable 10 unit PEG ADC linker used in the synthesis of antibody-drug conjugates (ADCs). m-PEG10-alcohol is also a PEG-based PROTAC linker that can be used in the synthesis of PROTACs. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Decaethylene glycol | 99.82% | Decaethylene glycol is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Agrocybin | Agrocybin is an antifungal peptide that exerts antifungal activity against several fungal species but lacks inhibitory activity against bacteria. Agrocybin attenuates the activity of HIV-1 reverse transcriptase. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
