178685-33-1
178685-33-1
Chemical Structure
Azide-PEG3-Tos
- CAS No.: 178685-33-1
- Formula:C13H19N3O5S
- Molecular Weight:329.37
IUPAC Name: 2-(2-(2-azidoethoxy)ethoxy)ethyl 4-methylbenzenesulfonate
InChIKey: PTOJCKLTCKYNFG-UHFFFAOYSA-N
SMILES: [N-]=[N+]=NCCOCCOCCOS(C1=CC=C(C)C=C1)(=O)=O
Biological Activity: Azide-PEG3-Tos is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. Azide-PEG3-Tos is also a non-cleavable 3 unit PEG ADC linker used in the synthesis of antibody-drug conjugates (ADCs)[2]. Azide-PEG3-Tos is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups.
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Azide-PEG3-Tos | 99.91% | Azide-PEG3-Tos is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs. Azide-PEG3-Tos is also a non-cleavable 3 unit PEG ADC linker used in the synthesis of antibody-drug conjugates (ADCs). Azide-PEG3-Tos is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Tos-PEG2-O-Propargyl | 98.16% | Tos-PEG2-O-Propargyl is a PEG-based PROTAC linker can be used in the synthesis of Thalidomide-O-PEG2-propargyl (HY-126458). Tos-PEG2-O-Propargyl is a click chemistry reagent, it contains an Alkyne group and can undergo copper-catalyzed azide-alkyne cycloaddition (CuAAc) with molecules containing Azide groups. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Tos-PEG2-CH2COOH | Tos-PEG2-CH2COOH is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Azide-PEG4-Tos | 99.59% | Azide-PEG4-Tos is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs. Azide-PEG4-Tos is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Azide-PEG5-Tos | 99.28% | Azide-PEG5-Tos is a cleavable 5 unit PEG ADC linker used in the synthesis of antibody-drug conjugates (ADCs). Azide-PEG5-Tos is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
H2N-PEG2-N3 (TosOH) | H2N-PEG2-N3 (TosOH) is a click chemistry reagent containing an Azide. N3-PEG2-Amine is used as a Click-chemistry linker in various applications. It contains an azide group and can undergo copper-catalyzed azide-alkyne cycloaddition (CuAAc) with molecules containing alkyne groups. It can also undergo ring strain-promoted alkyne-azide cycloaddition (SPAAC) with molecules containing DBCO or BCN groups. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Br-C2-PEG3-OTs | Br-C2-PEG3-OTs is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs, such as PROTAC STING degrader-4 (HY-176180). | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Tos-PEG3 | 97.0% | Tos-PEG3 is a PEG-based PROTAC linker can be used in the synthesis of PROTACs. Tos-PEG3 (structure 1) can be used for the synthesis of 3'-aminooxy oligonucleotides solid supports. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Tetraethylene glycol monotosylate | 97.0% | Tetraethylene glycol monotosylate is a cleavable and acylhydrazone-based ADC linker used in the synthesis of antibody-drug conjugates (ADCs). Tetraethylene glycol monotosylate also can be used as a PROTAC linker that can be used in the synthesis of PROTACs. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
m-PEG3-Tos | 98.75% | m-PEG3-Tos is a PEG-based PROTAC linker can be used in the synthesis of Silymarin (HY-W043277). | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
N3-PEG2-Tos | Azide-PEG2-Tos is a small PEG linker featuring an azide and a tosylate. Tosylates are good leaving groups which are easily displaced by nucleophiles while azide is a click chemistry handle which is used to react with terminal alkynes or strained cyclooctynes. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
References
- [1]. Borchmann DE, et al. GRGDS-Functionalized Poly(lactide)-graft-poly(ethylene glycol) Copolymers: Combining Thiol-Ene Chemistry with Staudinger Ligation. Macromolecules. 2013 Jun 11;46(11):4426-4431. [Content Brief]
- [2]. Park, Tae Kyo, et al. Compound bearing beta-galactoside-introduced self-immolative linker. WO2018124758A2.
