182347-24-6
182347-24-6
Chemical Structure
N3-PEG2-Tos
- CAS No.: 182347-24-6
- Formula:C11H15N3O4S
- Molecular Weight:285.32
IUPAC Name: 2-(2-azidoethoxy)ethyl 4-methylbenzenesulfonate
InChIKey: RJYBZWIZGFXXPN-UHFFFAOYSA-N
SMILES: O=S(C1=CC=C(C)C=C1)(OCCOCCN=[N+]=[N-])=O
Biological Activity: Azide-PEG2-Tos is a small PEG linker featuring an azide and a tosylate. Tosylates are good leaving groups which are easily displaced by nucleophiles while azide is a click chemistry handle which is used to react with terminal alkynes or strained cyclooctynes.
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
N3-PEG2-Tos | Azide-PEG2-Tos is a small PEG linker featuring an azide and a tosylate. Tosylates are good leaving groups which are easily displaced by nucleophiles while azide is a click chemistry handle which is used to react with terminal alkynes or strained cyclooctynes. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Tos-PEG1-O-CH2COOH | Tos-PEG1-O-CH2COOH (PROTAC Linker 28) is a PEG-based PROTAC linker can be used in the synthesis of PROTACs. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Azide-PEG3-Tos | 99.91% | Azide-PEG3-Tos is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs. Azide-PEG3-Tos is also a non-cleavable 3 unit PEG ADC linker used in the synthesis of antibody-drug conjugates (ADCs). Azide-PEG3-Tos is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Azide-PEG4-Tos | 99.59% | Azide-PEG4-Tos is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs. Azide-PEG4-Tos is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Propargyl-PEG2-Tos | Propargyl-PEG2-Tos is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs. Propargyl-PEG2-Tos is a click chemistry reagent, it contains an Alkyne group and can undergo copper-catalyzed azide-alkyne cycloaddition (CuAAc) with molecules containing Azide groups. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
H2N-PEG2-N3 (TosOH) | H2N-PEG2-N3 (TosOH) is a click chemistry reagent containing an Azide. N3-PEG2-Amine is used as a Click-chemistry linker in various applications. It contains an azide group and can undergo copper-catalyzed azide-alkyne cycloaddition (CuAAc) with molecules containing alkyne groups. It can also undergo ring strain-promoted alkyne-azide cycloaddition (SPAAC) with molecules containing DBCO or BCN groups. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Tos-PEG3 | 97.0% | Tos-PEG3 is a PEG-based PROTAC linker can be used in the synthesis of PROTACs. Tos-PEG3 (structure 1) can be used for the synthesis of 3'-aminooxy oligonucleotides solid supports. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
m-PEG2-Tos | 99.52% | m-PEG2-Tos is a uncleavable ADC linker used in the synthesis of antibody-drug conjugates (ADCs). m-PEG2-Tos is also a PEG-based PROTAC linker that can be used in the synthesis of PROTACs. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Tos-PEG2-OH | 95.74% | Tos-PEG2-OH is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Tos-PEG2-acid | Tos-PEG2-acid (compound 30) is a PEG linker containing a tosyl group and a terminal carboxylic acid. Tos-PEG2-acid can react with primary amine groups. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
5-Azidopentyl 4-methylbenzenesulfonate | 5-Azidopentyl 4-methylbenzenesulfonate (Tos-pentane-azide) is a linker containing an azide group and a tosyl group. The azide group can react with alkyne, BCN, DBCO via Click Chemistry to yield a stable triazole linkage. The tosyl group is a good leaving group for nucleophilic substitution reactions. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
