1951438-84-8
1951438-84-8
Chemical Structure
Propargyl-PEG6-acid
- CAS No.: 1951438-84-8
- Formula:C16H28O8
- Molecular Weight:348.39
IUPAC Name: 4,7,10,13,16,19-hexaoxadocos-21-ynoic acid
InChIKey: XRSJYQQOJNYUDV-UHFFFAOYSA-N
SMILES: C#CCOCCOCCOCCOCCOCCOCCC(O)=O
Biological Activity: Propargyl-PEG6-acid is a PEG-based PROTAC linker can be used in the synthesis of PROTACs. Propargyl-PEG6-acid is a cleavable ADC linker used in the synthesis of antibody-drug conjugates (ADCs)[1]. Propargyl-PEG6-acid is a click chemistry reagent, it contains an Alkyne group and can undergo copper-catalyzed azide-alkyne cycloaddition (CuAAc) with molecules containing Azide groups.
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Propargyl-PEG6-acid | Propargyl-PEG6-acid is a PEG-based PROTAC linker can be used in the synthesis of PROTACs. Propargyl-PEG6-acid is a cleavable ADC linker used in the synthesis of antibody-drug conjugates (ADCs). Propargyl-PEG6-acid is a click chemistry reagent, it contains an Alkyne group and can undergo copper-catalyzed azide-alkyne cycloaddition (CuAAc) with molecules containing Azide groups. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Propargyl-PEG5-acid | 99.82% | Propargyl-PEG5-acid is a non-cleavable 5 unit PEG ADC linker used in the synthesis of antibody-drug conjugates (ADCs). Propargyl-PEG5-acid can used to synthesize ADC inhibitors of Galectin-3. Propargyl-PEG5-acid is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs. Propargyl-PEG5-acid is a click chemistry reagent, it contains an Alkyne group and can undergo copper-catalyzed azide-alkyne cycloaddition (CuAAc) with molecules containing Azide groups. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Propargyl-PEG6-alcohol | 97.0% | Propargyl-PEG6-alcohol is a PEG-based PROTAC linker can be used in the synthesis of PROTACs. Propargyl-PEG6-alcohol is a click chemistry reagent, it contains an Alkyne group and can undergo copper-catalyzed azide-alkyne cycloaddition (CuAAc) with molecules containing Azide groups. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Propargyl-PEG7-acid | Propargyl-PEG7-acid is a PEG-based PROTAC linker can be used in the synthesis of PROTACs. Propargyl-PEG7-acid is a cleavable ADC linker used in the synthesis of antibody-drug conjugates (ADCs). Propargyl-PEG7-acid is a click chemistry reagent, it contains an Alkyne group and can undergo copper-catalyzed azide-alkyne cycloaddition (CuAAc) with molecules containing Azide groups. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Hydroxy-PEG6-acid | 98.0% | Hydroxy-PEG6-acid is a PEG-based non-cleavable ADC linker that can be used in the synthesis of Antibody-Drug Conjugates (ADCs). | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Thiol-PEG6-acid | Thiol-PEG6-acid is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Propargyl-PEG6-SH | Propargyl-PEG6-SH is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs. Propargyl-PEG6-SH is a click chemistry reagent, it contains an Alkyne group and can undergo copper-catalyzed azide-alkyne cycloaddition (CuAAc) with molecules containing Azide groups. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Propargyl-PEG6-Br | Propargyl-PEG6-Br is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs. Propargyl-PEG6-Br is a click chemistry reagent, it contains an Alkyne group and can undergo copper-catalyzed azide-alkyne cycloaddition (CuAAc) with molecules containing Azide groups. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Br-PEG6-C2-acid | Br-PEG6-C2-acid is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
NH2-PEG6-CH2CH2COOH | 97.0% | NH2-PEG6-CH2CH2COOH is a cleavable 6 unit PEG ADC linker used in the synthesis of antibody-drug conjugates (ADCs). NH2-PEG6-CH2CH2COOH is also a PEG-based PROTAC linker that can be used in the synthesis of PROTACs. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
m-PEG5-CH2CH2COOH | m-PEG5-CH2CH2COOH is a PEG-based based PROTAC linker can be used in the synthesis of PROTACs. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
