2055198-03-1
2055198-03-1
Chemical Structure
PC-Biotin-PEG4-NHS carbonate
- CAS No.: 2055198-03-1
- Formula:C35H50N6O14S
- Molecular Weight:810.87
IUPAC Name: 1-(5-(3,19-dioxo-23-((3aS,4S,6aR)-2-oxohexahydro-1H-thieno[3,4-d]imidazol-4-yl)-6,9,12,15-tetraoxa-2,18-diazatricosyl)-2-nitrophenyl)ethyl (2,5-dioxopyrrolidin-1-yl) carbonate
InChIKey: APFWBUQXFFFWPE-WMEVZKCTSA-N
SMILES: O=C1N[C@]2(CS[C@H]([C@]2(N1)[H])CCCCC(NCCOCCOCCOCCOCCC(NCC3=CC(C(OC(ON4C(CCC4=O)=O)=O)C)=C([N+]([O-])=O)C=C3)=O)=O)[H]
Biological Activity: PC-Biotin-PEG4-NHS carbonate is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
PC-Biotin-PEG4-NHS carbonate | 97.0% | PC-Biotin-PEG4-NHS carbonate is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Tetrazine-PEG4-biotin | 99.34% | Tetrazine-PEG4-biotin is a PEG ADC linker used in the synthesis of antibody-drug conjugates (ADCs). Tetrazine-PEG4-biotin is a click chemistry reagent, it contains a Tetrazine group that can undergo an inverse electron demand Diels-Alder reaction (iEDDA) with molecules containing TCO groups. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
PC Biotin-PEG3-alkyne | PC Biotin-PEG3-alkyne is a cleavable 3 unit PEG ADC linker used in the synthesis of antibody-drug conjugates (ADCs). PC Biotin-PEG3-alkyne is a click chemistry reagent, it contains an Alkyne group and can undergo copper-catalyzed azide-alkyne cycloaddition (CuAAc) with molecules containing Azide groups. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
PC Biotin-PEG3-azide | 97.75% | PC Biotin-PEG3-azide is a cleavable 3 unit PEG ADC linker used in the synthesis of antibody-drug conjugates (ADCs). PC Biotin-PEG3-azide is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
PC-Biotin-PEG4-PEG3-azide | PC-Biotin-PEG4-PEG3-azide is a cleavable 7 unit PEG ADC linker used in the synthesis of antibody-drug conjugates (ADCs). PC-Biotin-PEG4-PEG3-azide is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
PC Biotin-PEG3-NHS ester | 95.0% | PC Biotin-PEG3-NHS ester is a cleavable 3 unit PEG ADC linker used in the synthesis of antibody-drug conjugates (ADCs). | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Biotin-PEG4-NHS ester | 99.56% | Biotin-PEG4-NHS ester is a biotin-labeled, PEG-based PROTAC linker that can be used in the synthesis of PROTACs. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Biotin-PEG6-NHS ester | 98.0% | Biotin-PEG6-NHS ester is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Biotin-PEG4-MeTz | 95.32% | Biotin-PEG4-MeTz is a click chemistry reagent containing a terminal methyltetrazine group that reacts with trans-cyclooctene. Biotin-PEG4-MeTz can be used for the preparation of biotinylated conjugates. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
NHS-S-S-dPEG4-biotin (cleavable) | NHS-SS-dPEG4-biotin (cleavable) is a biodegradable crosslinker with efficient bioconjugation activity. NHS-SS-dPEG4-biotin (cleavable) can effectively connect biomolecules, optimize the efficiency of biolabeling, and be used in targeted compound delivery systems. NHS-SS-dPEG4-biotin (cleavable) can also play an important role in protein engineering and fluorescence imaging. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
NHS-PEG4-biotinidase resistant biotin | NHS-PEG4-biotinidase resistant biotin is a biotinylation reagent with a terminal NHS ester. The hydrophilic PEG spacer increases solubility in aqueous media. The NHS ester can be used to label the primary amines (-NH2) of proteins, amine-modified oligonucleotides, and other amine-containing molecules. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
