2093154-00-6
2093154-00-6
Chemical Structure
Propargyl-PEG7-acid
- CAS No.: 2093154-00-6
- Formula:C18H32O9
- Molecular Weight:392.44
IUPAC Name: 4,7,10,13,16,19,22-heptaoxapentacos-24-ynoic acid
InChIKey: VCXGERMSMMAGNQ-UHFFFAOYSA-N
SMILES: C#CCOCCOCCOCCOCCOCCOCCOCCC(O)=O
Biological Activity: Propargyl-PEG7-acid is a PEG-based PROTAC linker can be used in the synthesis of PROTACs. Propargyl-PEG7-acid is a cleavable ADC linker used in the synthesis of antibody-drug conjugates (ADCs)[1]. Propargyl-PEG7-acid is a click chemistry reagent, it contains an Alkyne group and can undergo copper-catalyzed azide-alkyne cycloaddition (CuAAc) with molecules containing Azide groups.
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Propargyl-PEG7-acid | Propargyl-PEG7-acid is a PEG-based PROTAC linker can be used in the synthesis of PROTACs. Propargyl-PEG7-acid is a cleavable ADC linker used in the synthesis of antibody-drug conjugates (ADCs). Propargyl-PEG7-acid is a click chemistry reagent, it contains an Alkyne group and can undergo copper-catalyzed azide-alkyne cycloaddition (CuAAc) with molecules containing Azide groups. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
m-PEG7-CH2CH2COOH | 97.0% | m-PEG7-CH2CH2COOH is a non-cleavable ADC linker used in the synthesis of antibody-drug conjugates (ADCs). m-PEG7-CH2CH2COOH is also a PEG-based PROTAC linker that can be used in the synthesis of PROTACs. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Propargyl-PEG7-alcohol | 97.0% | Propargyl-PEG7-alcohol is a PEG-based PROTAC linker can be used in the synthesis of PROTACs. Propargyl-PEG7-alcohol is a click chemistry reagent, it contains an Alkyne group and can undergo copper-catalyzed azide-alkyne cycloaddition (CuAAc) with molecules containing Azide groups. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Propargyl-PEG8-acid | 98.0% | Propargyl-PEG8-acid is a PEG-based PROTAC linker can be used in the synthesis of PROTACs. Propargyl-PEG8-acid is a cleavable ADC linker used in the synthesis of antibody-drug conjugates (ADCs). The ADCs can be used in bacterial infections caused by Gram-negative bacteria. Propargyl-PEG8-acid is a click chemistry reagent, it contains an Alkyne group and can undergo copper-catalyzed azide-alkyne cycloaddition (CuAAc) with molecules containing Azide groups. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Propargyl-PEG6-acid | Propargyl-PEG6-acid is a PEG-based PROTAC linker can be used in the synthesis of PROTACs. Propargyl-PEG6-acid is a cleavable ADC linker used in the synthesis of antibody-drug conjugates (ADCs). Propargyl-PEG6-acid is a click chemistry reagent, it contains an Alkyne group and can undergo copper-catalyzed azide-alkyne cycloaddition (CuAAc) with molecules containing Azide groups. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
HS-PEG7-CH2CH2COOH | HS-PEG7-CH2CH2COOH is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Propargyl-PEG9-acid | Propargyl-PEG9-acid is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs. Propargyl-PEG9-acid is a click chemistry reagent, it contains an Alkyne group and can undergo copper-catalyzed azide-alkyne cycloaddition (CuAAc) with molecules containing Azide groups. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Amino-PEG7-acid | Amino-PEG7-acid is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Propargyl-PEG7-methane | Propargyl-PEG7-methane is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs. Propargyl-PEG7-methane is a click chemistry reagent, it contains an Alkyne group and can undergo copper-catalyzed azide-alkyne cycloaddition (CuAAc) with molecules containing Azide groups. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
m-PEG6-CH2CH2COOH | m-PEG6-CH2CH2COOH is a PEG-based based PROTAC linker can be used in the synthesis of PROTACs. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Hydroxy-PEG7-C2-COOH | Hydroxy-PEG7-C2-COOH is a PROTAC linker that can be used in the synthesis of PROTACs. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
