2098497-01-7
2098497-01-7
Chemical Structure
6-Azido-D-lysine hydrochloride
- CAS No.: 2098497-01-7
- Formula:C6H13ClN4O2
- Molecular Weight:208.65
IUPAC Name: (S)-4-(tert-butyl)-2-(2-((R)-4-(tert-butyl)-4,5-dihydrooxazol-2-yl)-1,3-diphenylpropan-2-yl)-4,5-dihydrooxazole
InChIKey: RCEAACZNVVRXSJ-NUBCRITNSA-N
SMILES: OC([C@H](N)CCCCN=[N+]=[N-])=O.Cl
Biological Activity: 6-Azido-D-lysine hydrochloride is a click chemistry reagent containing an azide[1]. 6-Azido-D-lysine hydrochloride is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups.
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
6-Azido-D-lysine hydrochloride | ≥98.0% | 6-Azido-D-lysine hydrochloride is a click chemistry reagent containing an azide. 6-Azido-D-lysine hydrochloride is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
L-Azidonorleucine hydrochloride | 99.70% | L-Azidonorleucine hydrochloride, an unnatural amino acid, is A Methionine surrogate. L-Azidonorleucine hydrochloride can be used to label mammalian cell proteins and identify a diverse set of methionyl-tRNA synthetase (MetRS) mutants . L-Azidonorleucine (hydrochloride) is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
L-Azidohomoalanine | L-Azidohomoalanine is an alkyl chain-based PROTAC linker that can be used in the synthesis of PROTACs. L-Azidohomoalanine is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
L-Azidohomoalanine hydrochloride | 99.88% | L-Azidohomoalanine hydrochloride is an alkyl chain-based PROTAC linker that can be used in the synthesis of PROTACs. L-Azidohomoalanine (hydrochloride) is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
L-Azidohomoalanine-1,2,3,4-13C4 hydrochloride | L-Azidohomoalanine-1,2,3,4-13C4 (hydrochloride) is the 13C- and 15N-labeled L-Azidohomoalanine hydrochloride. L-Azidohomoalanine hydrochloride is an alkyl chain-based PROTAC linker that can be used in the synthesis of PROTACs. L-Azidohomoalanine-1,2,3,4-13C4 (hydrochloride) is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
3-Azido-D-alanine hydrochloride | 99.94% | 3-Azido-D-alanine (hydrochloride) is an orally active, selective metabolic tracer applicable for click chemistry labeling. 3-Azido-D-alanine (hydrochloride) can be selectively incorporated into bacterial cell wall peptidoglycans, introducing azido groups to enable copper-free click chemistry-based modification, labeling and single-cell tracing, while it cannot be metabolically incorporated by mammalian cells. 3-Azido-D-alanine (hydrochloride) can be used in studies related to bacterial infection, intracranial infection, otitis media, intestinal inflammation and tissue damage, as well as sepsis. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
6-Azido-D-lysine | 6-Azido-D-lysine is a click chemistry reagent containing an azide. 6-Azido-D-lysine is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
H-L-Orn(N3)-OH hydrochloride | H-L-Orn(N3)-OH (hydrochloride) is a click chemistry reagent containing an azide group. H-L-Orn(N3)-OH (hydrochloride) can be used for the research of various biochemical. It contains an azide group and can undergo copper-catalyzed azide-alkyne cycloaddition (CuAAc) with molecules containing alkyne groups. It can also undergo ring strain-promoted alkyne-azide cycloaddition (SPAAC) with molecules containing DBCO or BCN groups. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
H-D-Orn(N3)-OH hydrochloride | H-D-Orn(N3)-OH hydrochloride is a drug intermediate that can be introduced at the 5' end of oligonucleotides with a protected C6 amino linker by MMT, facilitating the subsequent deprotection and coupling of functional groups such as dyes and biotin. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
H-D-Aha-OH hydrochloride | ≥98.0% | H-D-Aha-OH (hydrochloride) is a click chemistry reagent containing an azide group. It contains an azide group and can undergo copper-catalyzed azide-alkyne cycloaddition (CuAAc) with molecules containing alkyne groups. It can also undergo ring strain-promoted alkyne-azide cycloaddition (SPAAC) with molecules containing DBCO or BCN groups. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
3-Azido-L-alanine hydrochloride | 98.0% | 3-Azido-L-alanine hydrochloride is an aliphatic functionalized amino acid with side chain lengths of up to four carbons. 3-Azido-L-alanine (hydrochloride) is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
