2182601-74-5
2182601-74-5
Chemical Structure
Propargyl-PEG8-NHS ester
- CAS No.: 2182601-74-5
- Formula:C24H39NO12
- Molecular Weight:533.57
IUPAC Name: 2,5-dioxopyrrolidin-1-yl 4,7,10,13,16,19,22,25-octaoxaoctacos-27-ynoate
InChIKey: PFFLYBWAOVXONG-UHFFFAOYSA-N
SMILES: C#CCOCCOCCOCCOCCOCCOCCOCCOCCC(ON1C(CCC1=O)=O)=O
Biological Activity: Propargyl-PEG8-NHS ester is a PEG/Alkyl/ether-based PROTAC linker can be used in the synthesis of PROTACs. Propargyl-PEG8-NHS ester is a cleavable ADC linker used in the synthesis of antibody-drug conjugates (ADCs)[1]. Propargyl-PEG8-NHS ester is a click chemistry reagent, it contains an Alkyne group and can undergo copper-catalyzed azide-alkyne cycloaddition (CuAAc) with molecules containing Azide groups.
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Propargyl-PEG8-NHS ester | 97.0% | Propargyl-PEG8-NHS ester is a PEG/Alkyl/ether-based PROTAC linker can be used in the synthesis of PROTACs. Propargyl-PEG8-NHS ester is a cleavable ADC linker used in the synthesis of antibody-drug conjugates (ADCs). Propargyl-PEG8-NHS ester is a click chemistry reagent, it contains an Alkyne group and can undergo copper-catalyzed azide-alkyne cycloaddition (CuAAc) with molecules containing Azide groups. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
m-PEG7-NHS ester | m-PEG7-NHS ester is a PEG-based PROTAC linker can be used in the synthesis of PROTACs. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Azido-PEG8-NHS ester | 99.47% | Azido-PEG8-NHS ester is a cleavable 8 unit PEG ADC linker used in the synthesis of antibody-drug conjugates (ADCs). Azido-PEG8-NHS ester is also a PEG- and Alkyl/ether-based PROTAC linker that can be used in the synthesis of PROTACs. Azido-PEG8-NHS ester is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Propargyl-PEG7-NHS ester | Propargyl-PEG7-NHS ester is a PEG/Alkyl/ether-based PROTAC linker can be used in the synthesis of PROTACs. Propargyl-PEG7-NHS ester is a cleavable ADC linker used in the synthesis of antibody-drug conjugates (ADCs). Propargyl-PEG7-NHS ester is a click chemistry reagent, it contains an Alkyne group and can undergo copper-catalyzed azide-alkyne cycloaddition (CuAAc) with molecules containing Azide groups. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Propargyl-PEG6-NHS ester | 98.0% | Propargyl-PEG6-NHS ester is a PEG/Alkyl/ether-based PROTAC linker can be used in the synthesis of PROTACs. Propargyl-PEG6-NHS ester is a cleavable ADC linker used in the synthesis of antibody-drug conjugates (ADCs). Propargyl-PEG6-NHS ester is a click chemistry reagent, it contains an Alkyne group and can undergo copper-catalyzed azide-alkyne cycloaddition (CuAAc) with molecules containing Azide groups. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
m-PEG9-NHS ester | 98.0% | m-PEG9-NHS ester is a PEG-based PROTAC linker can be used in the synthesis of PROTACs. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Azido-PEG7-NHS ester | Azido-PEG7-NHS ester is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs. Azido-PEG7-NHS ester is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Acid-PEG9-NHS ester | Acid-PEG9-NHS ester is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
m-PEG10-NHS ester | m-PEG10-NHS ester is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
m-PEG8-NHS ester | 99.54% | m-PEG8-NHS ester is a non-cleavable 8 unit PEG ADC linker used in the synthesis of antibody-drug conjugates (ADCs). | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
dPEG(R)8-SATA | 99.62% | dPEG(R)8-SATA (S-Acetyl-dPEG(R)8-NHS ester) is a bioconjugation reagent with excellent biocompatibility and high selectivity. dPEG(R)8-SATA can be used to label and cross-link biomolecules and promote the interaction between biomolecules. dPEG(R)8-SATA plays an important role in bioimaging and compound delivery systems. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
