2353409-82-0
2353409-82-0
Chemical Structure
Gly-Gly-Gly-PEG4-methyltetrazine
- CAS No.: 2353409-82-0
- Formula:C23H34N8O7
- Molecular Weight:534.57
IUPAC Name: 2-amino-N-(17-(4-(6-methyl-1,2,4,5-tetrazin-3-yl)phenoxy)-2,5-dioxo-9,12,15-trioxa-3,6-diazaheptadecyl)acetamide
InChIKey: CITOQRBUELLAMZ-UHFFFAOYSA-N
SMILES: CC1=NN=C(N=N1)C2=CC=C(C=C2)OCCOCCOCCOCCNC(CNC(CNC(CN)=O)=O)=O
Biological Activity: Gly-Gly-Gly-PEG4-methyltetrazine is a cleavable 4 unit PEG ADC linker used in the synthesis of antibody-drug conjugates (ADCs)[1]. Gly-Gly-Gly-PEG4-methyltetrazine is a click chemistry reagent, it contains a Tetrazine group that can undergo an inverse electron demand Diels-Alder reaction (iEDDA) with molecules containing TCO groups.
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Gly-Gly-Gly-PEG4-methyltetrazine | 99.29% | Gly-Gly-Gly-PEG4-methyltetrazine is a cleavable 4 unit PEG ADC linker used in the synthesis of antibody-drug conjugates (ADCs). Gly-Gly-Gly-PEG4-methyltetrazine is a click chemistry reagent, it contains a Tetrazine group that can undergo an inverse electron demand Diels-Alder reaction (iEDDA) with molecules containing TCO groups. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Methyltetrazine-Ph-PEG4-azide | Methyltetrazine-Ph-PEG4-azide is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs. Methyltetrazine-Ph-PEG4-azide is a click chemistry reagent, it contains a Tetrazine group that can undergo an inverse electron demand Diels-Alder reaction (iEDDA) with molecules containing TCO groups. It contains an azide group and can undergo copper-catalyzed azide-alkyne cycloaddition (CuAAc) with molecules containing alkyne groups. It can also undergo ring strain-promoted alkyne-azide cycloaddition (SPAAC) with molecules containing DBCO or BCN groups. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Methyltetrazine-PEG4-amine | Methyltetrazine-PEG4-amine is a linker for antibody-drug conjugates and a click chemistry reagent that can be used for the synthesis of ADCs. Methyltetrazine-PEG4-amine can be used to synthesize click-active albumin-binding radioligands as well as VLA-4-targeted radiopharmaceutical precursors. Methyltetrazine-PEG4-amine is applicable to research related to prostate cancer. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Methyltetrazine-PEG4-amine hydrochloride | 99.50% | Methyltetrazine-PEG4-amine hydrochloride is a linker for antibody-drug conjugates and a click chemistry reagent that can be used for the synthesis of ADCs. Methyltetrazine-PEG4-amine hydrochloride can be used to synthesize click-active albumin-binding radioligands as well as VLA-4-targeted radiopharmaceutical precursors. Methyltetrazine-PEG4-amine hydrochloride is applicable to research related to prostate cancer. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Methyltetrazine-PEG4-acid | 99.81% | Methyltetrazine-PEG4-acid is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Methyltetrazine-PEG8-acid | 99.02% | Methyltetrazine-PEG8-acid is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Methyltetrazine-PEG5-NHS ester | 97.0% | Methyltetrazine-PEG5-NHS ester is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Methyltetrazine-PEG5-alkyne | 98.0% | Methyltetrazine-PEG5-alkyne is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Methyltetrazine-PEG4-maleimide | 98.61% | Methyltetrazine-PEG4-maleimide is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs. Methyltetrazine-PEG4-maleimide is a click chemistry reagent, it contains a Tetrazine group that can undergo an inverse electron demand Diels-Alder reaction (iEDDA) with molecules containing TCO groups. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Methyltetrazine-PEG4-NH-Boc | Methyltetrazine-PEG4-NH-Boc is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Tz-Ph-PEG4-NH-DOTA | Tz-Ph-PEG4-NH-DOTA (Compound 10) is a 1,2,4,5-tetrazine (Tz) derivative. Tz-Ph-PEG4-NH-DOTA can be used in PET imaging and tumor research. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
