2401831-99-8
2401831-99-8
Chemical Structure
t-Boc-Aminooxy-PEG4-NHS ester
- CAS No.: 2401831-99-8
- Formula:C20H34N2O11
- Molecular Weight:478.49
IUPAC Name: 2,5-dioxopyrrolidin-1-yl 2,2-dimethyl-4-oxo-3,6,9,12,15,18-hexaoxa-5-azahenicosan-21-oate
InChIKey: VNCXPIZEFLGDMH-UHFFFAOYSA-N
SMILES: O=C(OC(C)(C)C)NOCCOCCOCCOCCOCCC(ON1C(CCC1=O)=O)=O
Biological Activity: t-Boc-Aminooxy-PEG4-NHS ester is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
t-Boc-Aminooxy-PEG4-NHS ester | 99.83% | t-Boc-Aminooxy-PEG4-NHS ester is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Boc-N-PEG5-C2-NHS ester | 96.91% | Boc-N-PEG5-C2-NHS ester is a PEG-based PROTAC linker can be used in the synthesis of PROTACs. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Propargyl-PEG5-NHS ester | 98.26% | Propargyl-PEG5-NHS ester is a PEG/Alkyl/ether-based PROTAC linker can be used in the synthesis of PROTACs. Propargyl-PEG5-NHS ester is a cleavable ADC linker used in the synthesis of antibody-drug conjugates (ADCs). Propargyl-PEG5-NHS ester is a click chemistry reagent, it contains an Alkyne group and can undergo copper-catalyzed azide-alkyne cycloaddition (CuAAc) with molecules containing Azide groups. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Acid-C2-PEG4-C2-NHS ester | 98.0% | Acid-C2-PEG4-C2-NHS ester is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
m-PEG5-NHS ester | 98.0% | m-PEG5-NHS ester is a PEG-based PROTAC linker can be used in the synthesis of PROTACs. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
m-PEG6-NHS ester | 97.0% | m-PEG6-NHS ester is a non-cleavable 6 unit PEG ADC linker used in the synthesis of antibody-drug conjugates (ADCs). m-PEG6-NHS ester is a PEG/Alkyl/ether-based PROTAC linker can be used in the synthesis of PROTACs. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Boc-NH-PEG3-NHS ester | 98.0% | Boc-NH-PEG3-NHS ester is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Boc-NH-PEG4-NHS ester | 98.76% | Boc-NH-PEG4-NHS ester is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Boc-PEG4-C2-NHS ester | Boc-PEG4-C2-NHS ester is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
dPEG(R)4-SATA | 98.0% | dPEG(R)4-SATA is a PEG derivative that can be used for drug delivery research, etc. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Acid-PEG4-NHS ester | 95.0% | Acid-PEG4-NHS ester is a PEG4-based PROTAC linker that can be used for the synthesis of PROTACs. Acid-PEG4-NHS ester contains a carboxylic acid and an NHS ester; the carboxylic acid reacts with primary amines in the presence of activators such as EDC or HATU, while the NHS ester also reacts with primary amines, enabling PEGylation and bioconjugation of primary amine-containing molecules. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
