2434639-17-3
Chemical Structure
3,4-Dibromo-Mal-PEG4-Acid
- CAS No.: 2434639-17-3
- Formula:C15H21Br2NO8
- Molecular Weight:503.14
IUPAC Name: 1-(3,4-dibromo-2,5-dioxo-2,5-dihydro-1H-pyrrol-1-yl)-3,6,9,12-tetraoxapentadecan-15-oic acid
InChIKey: JMJVXNRBNZBUFV-UHFFFAOYSA-N
SMILES: O=C(CCOCCOCCOCCOCCN1C(C(Br)=C(C1=O)Br)=O)O
Biological Activity: 3,4-Dibromo-Mal-PEG4-acid is a site specific ADC linker with a dibromomaleimide group and an acid group. The dibromomaleimide group allows for two points of substitution due to the two bromine atoms. The carboxylic acid can react with primary amines in the presence of EDC and HATU to form a stable amide bond. The hydrophilic PEG linker increases the water solubility of compounds in aqueous media.
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
3,4-Dibromo-Mal-PEG4-Acid | 95.20% | 3,4-Dibromo-Mal-PEG4-acid is a site specific ADC linker with a dibromomaleimide group and an acid group. The dibromomaleimide group allows for two points of substitution due to the two bromine atoms. The carboxylic acid can react with primary amines in the presence of EDC and HATU to form a stable amide bond. The hydrophilic PEG linker increases the water solubility of compounds in aqueous media. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Mal-PEG4-acid | 95.0% | Mal-PEG4-acid is a PEG-based PROTAC linker can be used in the synthesis of PROTACs. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Mal-PEG5-acid | 96.0% | Mal-PEG5-acid is a PEG-based PROTAC linker can be used in the synthesis of PROTACs. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Mal-PEG6-acid | 98.81% | Mal-PEG6-acid is a PEG-based PROTAC linker can be used in the synthesis of PROTACs. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Maleimido-tri(ethylene glycol)-propionic acid | 98.0% | Maleimido-tri(ethylene glycol)-propionic acid is a cleavable ADC linker used in the synthesis of antibody-drug conjugates (ADCs). Maleimido-tri(ethylene glycol)-propionic acid is used for the preparation of neolymphostin-based ADC precursors for site-specific cysteine mutant trastuzumab-A114C conjugation. Maleimido-tri(ethylene glycol)-propionic acid also can be used as a PEG-based PROTAC linker that can be used in the synthesis of PROTACs. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Mal-PEG4-Boc | 99.93% | Mal-PEG4-Boc is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
3,4-Dibromo-Mal-PEG2-amine | 3,4-Dibromo-Mal-PEG2-amine is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
3,4-Dibromo-Mal-PEG2-amine TFA | 98.0% | 3,4-Dibromo-Mal-PEG2-amine TFA is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
3,4-Dibromo-Mal-PEG2-N-Boc | 95.31% | 3,4-Dibromo-Mal-PEG2-N-Boc is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
3,4-Dibromo-Mal-PEG4-Boc | 3,4-Dibromo-Mal-PEG4-Boc is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
3,4-Dibromo-Mal-PEG8-Boc | 98.0% | 3,4-Dibromo-Mal-PEG8-Boc is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
