2698339-31-8
2698339-31-8
Chemical Structure
DBCO-NHCO-PEG2-maleimide
- CAS No.: 2698339-31-8
- Formula:C32H34N4O7
- Molecular Weight:586.63
InChIKey: RNZYXLRPJHTQSV-UHFFFAOYSA-N
SMILES: O=C(CCNC(CCOCCOCCNC(CCN1C(C=CC1=O)=O)=O)=O)N2C3=CC=CC=C3C#CC4=CC=CC=C4C2
Biological Activity: DBCO-NHCO-PEG2-maleimide is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. DBCO-NHCO-PEG2-maleimide is a click chemistry reagent, it contains a DBCO group that can undergo strain-promoted alkyne-azide cycloaddition (SPAAC) with molecules containing Azide groups.
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
DBCO-NHCO-PEG2-maleimide | 98.02% | DBCO-NHCO-PEG2-maleimide is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs. DBCO-NHCO-PEG2-maleimide is a click chemistry reagent, it contains a DBCO group that can undergo strain-promoted alkyne-azide cycloaddition (SPAAC) with molecules containing Azide groups. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
DBCO-Maleimide | 99.83% | DBCO-Maleimide is a non-cleavable ADC linker used in the synthesis of antibody-drug conjugates (ADCs). DBCO-Maleimide is a click chemistry reagent, it contains a DBCO group that can undergo strain-promoted alkyne-azide cycloaddition (SPAAC) with molecules containing Azide groups. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
DBCO-PEG4-acid | 98.87% | DBCO-PEG4-acid is a a PEG-based PROTAC linker that can be used in the synthesis of PROTACs. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
DBCO-PEG4-Maleimide | 97.85% | DBCO-PEG4-Maleimide is a non-cleavable ADC linker used in the synthesis of antibody-drug conjugates (ADCs). DBCO-PEG4-Maleimide is a click chemistry reagent, it contains a DBCO group that can undergo strain-promoted alkyne-azide cycloaddition (SPAAC) with molecules containing Azide groups. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
DBCO-NHCO-PEG2-amine | DBCO-NHCO-PEG2-amine is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs. DBCO-NHCO-PEG2-amine is a click chemistry reagent, it contains a DBCO group that can undergo strain-promoted alkyne-azide cycloaddition (SPAAC) with molecules containing Azide groups. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
DBCO-NHCO-PEG3-acid | DBCO-NHCO-PEG3-acid is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs. DBCO-NHCO-PEG3-acid is a click chemistry reagent, it contains a DBCO group that can undergo strain-promoted alkyne-azide cycloaddition (SPAAC) with molecules containing Azide groups. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
DBCO-NHCO-PEG6-maleimide | DBCO-NHCO-PEG6-maleimide is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs. DBCO-NHCO-PEG6-maleimide is a click chemistry reagent, it contains a DBCO group that can undergo strain-promoted alkyne-azide cycloaddition (SPAAC) with molecules containing Azide groups. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
DBCO-NHCO-PEG2-NHS ester | DBCO-NHCO-PEG2-NHS ester is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs. DBCO-NHCO-PEG2-NHS ester is a click chemistry reagent, it contains a DBCO group that can undergo strain-promoted alkyne-azide cycloaddition (SPAAC) with molecules containing Azide groups. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
DBCO-NHCO-PEG2-CH2COOH | DBCO-NHCO-PEG2-CH2COOH is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs. DBCO-NHCO-PEG2-CH2COOH is a click chemistry reagent, it contains a DBCO group that can undergo strain-promoted alkyne-azide cycloaddition (SPAAC) with molecules containing Azide groups. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Sulfo DBCO-PEG4-Maleimide | Sulfo DBCO-PEG4-Maleimide is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs. Sulfo DBCO-PEG4-Maleimide is a click chemistry reagent, it contains a DBCO group that can undergo strain-promoted alkyne-azide cycloaddition (SPAAC) with molecules containing Azide groups. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Bromoacetamide-PEG4-DBCO | Bromoacetamide-PEG4-DBCO (Compound bromoacetamido-dPEG ®4-amido-DBCO) is a ADC linker and can be used for synthesis of antibody-drug conjugates (ADCs). | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
