4418-26-2
Chemical Structure
Dehydroacetic acid sodium
Synonym(s): Sodium dehydroacetate
- CAS No.: 4418-26-2
- Formula:C8H7NaO4
- Molecular Weight:190.13
IUPAC Name: sodium 3-acetyl-6-methyl-2,4-dioxo-3,4-dihydro-2H-pyran-3-ide
InChIKey: YIOCQGHBBNGBND-UHFFFAOYSA-N
SMILES: CC([C-](C(O1)=O)C(C=C1C)=O)=O.[Na+]
Biological Activity: Dehydroacetic acid sodium (Biocide 470F sodium) is a pyrone derivative. Dehydroacetic acid sodium has antibacterial, antifungal and phytotoxic activities. Dehydroacetic acid sodium can be added to cosmetics, food and beverages for preservation and other purposes. Dehydroacetic acid sodium can also be used to synthesize various heterocycles and cycloaddition products[1][2].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Dehydroacetic acid sodium | 99.87% | Dehydroacetic acid sodium (Biocide 470F sodium) is a pyrone derivative. Dehydroacetic acid sodium has antibacterial, antifungal and phytotoxic activities. Dehydroacetic acid sodium can be added to cosmetics, food and beverages for preservation and other purposes. Dehydroacetic acid sodium can also be used to synthesize various heterocycles and cycloaddition products. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Dehydroacetic acid sodium (Standard) | ≥98% | Dehydroacetic acid sodium (Standard) (Sodium dehydroacetate (Standard)) is the analytical standard of Dehydroacetic acid sodium (HY-128467). This product is intended for research and analytical applications. Dehydroacetic acid sodium (Biocide 470F sodium) is a pyrone derivative. Dehydroacetic acid sodium has antibacterial, antifungal and phytotoxic activities. Dehydroacetic acid sodium can be added to cosmetics, food and beverages for preservation and other purposes. Dehydroacetic acid sodium can also be used to synthesize various heterocycles and cycloaddition products. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
