846549-37-9
846549-37-9
Chemical Structure
2-((Azido-PEG8-carbamoyl)methoxy)acetic acid
- CAS No.: 846549-37-9
- Formula:C22H42N4O12
- Molecular Weight:554.59
IUPAC Name: 32-azido-5-oxo-3,9,12,15,18,21,24,27,30-nonaoxa-6-azadotriacontanoic acid
InChIKey: WWDNBBVPYDZICO-UHFFFAOYSA-N
SMILES: O=C(O)COCC(NCCOCCOCCOCCOCCOCCOCCOCCOCCN=[N+]=[N-])=O
Biological Activity: 2-((Azido-PEG8-carbamoyl)methoxy)acetic acid is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. 2-((Azido-PEG8-carbamoyl)methoxy)acetic acid is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups.
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
2-((Azido-PEG8-carbamoyl)methoxy)acetic acid | 98.59% | 2-((Azido-PEG8-carbamoyl)methoxy)acetic acid is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs. 2-((Azido-PEG8-carbamoyl)methoxy)acetic acid is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
N3-PEG8-CH2COOH | N3-PEG8-CH2COOH is a PEG-based PROTAC linker can be used in the synthesis of PROTACs. N3-PEG8-CH2COOH is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Azido-PEG9-acid | 97.74% | Azido-PEG9-acid is a non-cleavable 9 unit PEG ADC linker used in the synthesis of antibody-drug conjugates (ADCs). Azido-PEG9-acid is a PEG-based PROTAC linker can be used in the synthesis of PROTACs. Azido-PEG9-acid is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Azido-PEG11-CH2COOH | Azido-PEG11-CH2COOH is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs. Azido-PEG11-CH2COOH is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Azido-PEG8-NHBoc | Azido-PEG8-NHBoc is a PEG-based PROTAC linker can be used in the synthesis of PROTACs. Azido-PEG8-NHBoc is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Azido-PEG8-acid | 98.0% | Azido-PEG8-acid is a non-cleavable 8 unit PEG ADC linker used in the synthesis of antibody-drug conjugates (ADCs). Azido-PEG8-acid is also a PEG-based PROTAC linker that can be used in the synthesis of PROTACs. Azido-PEG8-acid is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Azido-PEG10-acid | 99.88% | Azido-PEG10-acid is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs. Azido-PEG10-acid is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Azido-PEG9-alcohol | 95.0% | Azido-PEG9-alcohol is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs. Azido-PEG9-alcohol is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Azido-PEG10-alcohol | 97.0% | Azido-PEG10-alcohol is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs. Azido-PEG10-alcohol is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Bromoacetamido-PEG8-acid | Bromoacetamido-PEG8-acid is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Iodoacetamido-PEG8-acid | Iodoacetamido-PEG8-acid is a PEG reagent containing an Iodoacetamide group and a carboxlic acid moiety. The terminal carboxylic acid can react with primary amine groups in the presence of activators (e.g. EDC, or HATU) to form a stable amide bond. The iodoacetamide group is an alkylating agent that can be used to bind covalently with the thiol group. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
