869310-84-9
869310-84-9
Chemical Structure
Propargyl-PEG2-NHBoc
- CAS No.: 869310-84-9
- Formula:C12H21NO4
- Molecular Weight:243.30
IUPAC Name: tert-butyl (2-(2-(prop-2-yn-1-yloxy)ethoxy)ethyl)carbamate
InChIKey: WBOOWEAGRWGHMV-UHFFFAOYSA-N
SMILES: O=C(NCCOCCOCC#C)OC(C)(C)C
Biological Activity: Propargyl-PEG2-NHBoc is a cleavable ADC linker used in the synthesis of antibody-drug conjugates (ADCs). Propargyl-PEG2-NHBoc is a PEG-based PROTAC linker can be used in the synthesis of PROTACs[1]. Propargyl-PEG2-NHBoc is a click chemistry reagent, it contains an Alkyne group and can undergo copper-catalyzed azide-alkyne cycloaddition (CuAAc) with molecules containing Azide groups.
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Propargyl-PEG2-NHBoc | 97.0% | Propargyl-PEG2-NHBoc is a cleavable ADC linker used in the synthesis of antibody-drug conjugates (ADCs). Propargyl-PEG2-NHBoc is a PEG-based PROTAC linker can be used in the synthesis of PROTACs. Propargyl-PEG2-NHBoc is a click chemistry reagent, it contains an Alkyne group and can undergo copper-catalyzed azide-alkyne cycloaddition (CuAAc) with molecules containing Azide groups. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
BOC-NH-PEG2-propene | BOC-NH-PEG2-propene is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Boc-NH-PEG3-propargyl | 97.0% | Boc-NH-PEG3-propargyl is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs. Boc-NH-PEG3-propargyl is a click chemistry reagent, it contains an Alkyne group and can undergo copper-catalyzed azide-alkyne cycloaddition (CuAAc) with molecules containing Azide groups. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Boc-N-Amido-PEG4-propargyl | 99.73% | Boc-N-Amido-PEG4-propargyl is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs. Boc-N-Amido-PEG4-propargyl is a click chemistry reagent, it contains an Alkyne group and can undergo copper-catalyzed azide-alkyne cycloaddition (CuAAc) with molecules containing Azide groups. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Boc-NH-PEG2-CH2COOH | 99.81% | Boc-NH-PEG2-CH2COOH is a PEG-based PROTAC linker can be used in the synthesis of PROTACs. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
N-Boc-PEG2-bromide | 98.0% | N-Boc-PEG2-bromide is a PEG/Alkyl/ether-based PROTAC linker can be used in the synthesis of PROTACs. N-Boc-PEG2-bromide is a cleavable ADC linker used in the synthesis of antibody-drug conjugates (ADCs). | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Boc-NH-PEG2-C2-NH2 | 99.38% | Boc-NH-PEG2-C2-NH2 (PROTAC Linker 13) is a PEG-based PROTAC linker can be used in the synthesis of PROTACs. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Boc-NH-PEG3 | 98.0% | Boc-NH-PEG3 (PROTAC Linker 10) is a PEG-based PROTAC linker can be used in the synthesis of PROTACs. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
tert-Butyl (2-(2-(2-iodoethoxy)ethoxy)ethyl)carbamate | tert-Butyl (2-(2-(2-iodoethoxy)ethoxy)ethyl)carbamate is a PEG linker containing a Boc protected amine and an iodine group. The protected amine can be deprotected under mild acidic conditions. Iodine (I) is a very good leaving group for nucleophilic substitution reactions. The hydrophilic PEG spacer increases solubility in aqueous media. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
BocNH-PEG2-CH2CH2NHMe | BocNH-PEG2-CH2CH2NHMe is a PROTAC linker that can be used in the synthesis of PROTACs. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Boc-PEG2-but-1-yne | Boc-PEG2-but-1-yne is a PROTAC linker that can be used in the synthesis of PROTACs. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
