164159-88-0
164159-88-0
Chemical Structure
Antascomicin B
- CAS No.: 164159-88-0
- Formula:C38H59NO11
- Molecular Weight:705.88
InChIKey: PAIQYESGYQIDED-FQQHRFRBSA-N
SMILES: O=C([C@@](CCCC1)([H])N1C(C([C@@]2(O)[C@H](C)CC[C@@](O2)([H])[C@H]3C)=O)=O)O[C@H]([C@H](C)C[C@H]4[C@H](O)[C@](OC)(O)[C@H](O)CC4)CC[C@H](C)/C=C/CC/C=C/C3=O
Biological Activity: Antascomicin B is a macrocyclic natural product that binds purified human FKBP12, FKBP12.6, FKBP51, and FKBP52. Antascomicin B acts as a molecular glue that binds the FK1 domain to stabilize the FKBP51-Akt1 complex, with a Kd of 6.7 nM for human FKBP51, independent of AKT activation status and Hsp90 binding[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Antascomicin B | Antascomicin B is a macrocyclic natural product that binds purified human FKBP12, FKBP12.6, FKBP51, and FKBP52. Antascomicin B acts as a molecular glue that binds the FK1 domain to stabilize the FKBP51-Akt1 complex, with a Kd of 6.7 nM for human FKBP51, independent of AKT activation status and Hsp90 binding. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
