23789-03-9
23789-03-9
Chemical Structure
TMA chloride-d12 chloride
Synonym(s): Tetramethylammonium chloride-d12 chloride
- CAS No.: 23789-03-9
- Formula:C4D12ClN
- Molecular Weight:121.67
IUPAC Name: methyl 3-(methylamino)benzoate hydrochloride
InChIKey: OKIZCWYLBDKLSU-KXWZVCIVSA-M
SMILES: [2H]C([2H])([2H])[N+](C([2H])([2H])[2H])(C([2H])([2H])[2H])C([2H])([2H])[2H].[Cl-]
Biological Activity: Tetramethylammonium-d12 (chloride) is the deuterium labeled Tetramethylammonium chloride[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
TMA chloride-d12 chloride | 99.94% | Tetramethylammonium-d12 (chloride) is the deuterium labeled Tetramethylammonium chloride. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
TMA chloride, for molecular biology, 99%(T) | 98.0% | TMA chloride, for molecular biology, 99%(T) (Tetramethylammonium chloride, for molecular biology, 99%(T)) can increase the specificity of hybridization and raise the DNA denaturation temperature in PCR. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Trimethylamine N-oxide-d9 | 99.76% | Trimethylamine N-oxide-d9 is the deuterium labeled Trimethylamine N-oxide. Trimethylamine N-oxide is a gut microbe-dependent metabolite of dietary choline and other trimethylamine-containing nutrients. Trimethylamine N-oxide induces inflammation by activating the ROS/NLRP3 inflammasome. Trimethylamine N-oxide also accelerates fibroblast-myofibroblast differentiation and induces cardiac fibrosis by activating the TGF-β/smad2 signaling pathway. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Choline-d9 chloride | 99.98% | Choline-d9 chloride is the d9-labeled Choline chloride (HY-B1337). Choline chloride is an orally active methylxanthine derivative. Choline chloride exhibits weak antihistaminic and anticholinergic activities and potentiates the effects of histamine and acetylcholine. Choline chloride relaxes bronchial smooth muscle, dilates coronary and peripheral blood vessels, increases urine output and electrolyte excretion, stimulates locomotor activity in the central nervous system, and induces transient hypotension following a pressor phase. Choline chloride modulates sleep architecture by increasing wakefulness time and reducing slow-wave sleep, without altering the frequency or severity of nocturnal hypoxemia, apnea, or hypopnea events. Choline chloride is used in studies of bronchospasm, nocturnal asthma, and chronic asthma. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Chlorocholine-d9 chloride | Chlorocholine-d9 (chloride) is the deuterium labeled Chlorocholine chloride. Chlorocholine chloride is an effective plant growth regulator. Chlorocholine chloride can inhibit gibberellin (GA) biosynthesis. Chlorocholine chloride can be used for the research of the mechanisms and effects of GA on plant cell growth and differentiation. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
1,1,3,3-Tetramethylurea-d12 | 98.17% | 1,1,3,3-Tetramethylurea-d12 is the deuterium labeled 1,1,3,3-Tetramethylurea. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Diethylamine-d10 hydrobromide | 99% | Diethylamine-d10 hydrobromide is the deuterium labeled Diethylamine hydrobromide. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Choline-d9 bromide | Choline-d9 (bromide) is the deuterium labeled Choline bromide. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Cholamine-d9 | Cholamine-d9 is the deuterium labeled Cholamine. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Tetramethyl-ammonium Bromide-d12 | Tetramethyl-ammonium Bromide-d12 is the deuterium labeled TMAB. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
